C20H21N5O2S — CID 155680531
4-amino-6-(3-methoxy-5-phenylmethoxyanilino)-2-methylpyrimidine-5-carbothioamide (PubChem CID 155680531) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 4-amino-6-(3-methoxy-5-phenylmethoxyanilino)-2-methylpyrimidine-5-carbothioamide.
| Compound Name | 4-amino-6-(3-methoxy-5-phenylmethoxyanilino)-2-methylpyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 155680531 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-amino-6-(3-methoxy-5-phenylmethoxyanilino)-2-methylpyrimidine-5-carbothioamide |
| SMILES | COc1cc(Nc2nc(C)nc(N)c2C(N)=S)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-12-23-18(21)17(19(22)28)20(24-12)25-14-8-15(26-2)10-16(9-14)27-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H2,22,28)(H3,21,23,24,25) |
| InChIKey | BNGCWDCAPWMMRL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|