C23H25FN4O4S — CID 155681182
(4-carbamimidoyl-2-fluorophenyl) 2-[ethyl-(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 155681182) has the molecular formula C23H25FN4O4S and a molecular weight of 472.54 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 2-[ethyl-(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 2-[ethyl-(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 155681182 |
| Molecular Formula | C23H25FN4O4S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 2-[ethyl-(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3nc(N(CC)CC(C)(C)C(=O)OC)sc3c2)c(F)c1 |
| InChI | InChI=1S/C23H25FN4O4S/c1-5-28(12-23(2,3)21(30)31-4)22-27-16-8-6-14(11-18(16)33-22)20(29)32-17-9-7-13(19(25)26)10-15(17)24/h6-11H,5,12H2,1-4H3,(H3,25,26) |
| InChIKey | ZUFSPRICYDWKPO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|