C21H22N4O4S — CID 155681193
(4-carbamimidoylphenyl) 2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 155681193) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-carbamimidoylphenyl) 2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 155681193 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (4-carbamimidoylphenyl) 2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3nc(NCC(C)(C)C(=O)OC)sc3c2)cc1 |
| InChI | InChI=1S/C21H22N4O4S/c1-21(2,19(27)28-3)11-24-20-25-15-9-6-13(10-16(15)30-20)18(26)29-14-7-4-12(5-8-14)17(22)23/h4-10H,11H2,1-3H3,(H3,22,23)(H,24,25) |
| InChIKey | CXLJZDSMQYTCJG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|