C18F34 — CID 155681371
3,3,4,4-tetrafluoro-1,2-bis[1,1,1,2,2,4,5,5,5-nonafluoro-3,4-bis(trifluoromethyl)pentan-3-yl]cyclobutene (PubChem CID 155681371) has the molecular formula C18F34 and a molecular weight of 862.13 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,2,2,4,5,5,5-nonafluoro-3,4-bis(trifluoromethyl)pentan-3-yl]cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,2,2,4,5,5,5-nonafluoro-3,4-bis(trifluoromethyl)pentan-3-yl]cyclobutene |
|---|---|
| PubChem CID | 155681371 |
| Molecular Formula | C18F34 |
| Molecular Weight | 862.13 g/mol |
| Exact Mass | 861.95 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,2,2,4,5,5,5-nonafluoro-3,4-bis(trifluoromethyl)pentan-3-yl]cyclobutene |
| SMILES | FC(F)(F)C(F)(F)C(C1=C(C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18F34/c19-5(20)1(3(11(29,30)31,9(25,26)17(47,48)49)7(23,13(35,36)37)14(38,39)40)2(6(5,21)22)4(12(32,33)34,10(27,28)18(50,51)52)8(24,15(41,42)43)16(44,45)46 |
| InChIKey | MZNVRYRWYMZSDT-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.13 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|