C10F18 — CID 155681372
1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,4,4,4-octafluoro-2-(trifluoromethyl)butan-2-yl]cyclopentene (PubChem CID 155681372) has the molecular formula C10F18 and a molecular weight of 462.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,4,4,4-octafluoro-2-(trifluoromethyl)butan-2-yl]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,4,4,4-octafluoro-2-(trifluoromethyl)butan-2-yl]cyclopentene |
|---|---|
| PubChem CID | 155681372 |
| Molecular Formula | C10F18 |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,4,4,4-octafluoro-2-(trifluoromethyl)butan-2-yl]cyclopentene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F18/c11-2-1(4(12,13)7(18,19)5(2,14)15)3(8(20,21)22,9(23,24)25)6(16,17)10(26,27)28 |
| InChIKey | RJZCPQSTMHQNFI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|