C7F12 — CID 155681381
1,3,3,4,4-pentafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene (PubChem CID 155681381) has the molecular formula C7F12 and a molecular weight of 312.05 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene |
|---|---|
| PubChem CID | 155681381 |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene |
| SMILES | FC1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7F12/c8-2-1(4(10,11)5(2,12)13)3(9,6(14,15)16)7(17,18)19 |
| InChIKey | UTGVLFPFJVDRKP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|