C16F30 — CID 155681383
3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene (PubChem CID 155681383) has the molecular formula C16F30 and a molecular weight of 762.12 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 155681383 |
| Molecular Formula | C16F30 |
| Molecular Weight | 762.12 g/mol |
| Exact Mass | 761.95 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C1=C(C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C16F30/c17-3(13(35,36)37,7(23,24)11(31,32)15(41,42)43)1-2(6(21,22)10(29,30)9(27,28)5(1,19)20)4(18,14(38,39)40)8(25,26)12(33,34)16(44,45)46 |
| InChIKey | HYRUIQHOMCNICU-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.12 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|