C15F28 — CID 155681389
3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene (PubChem CID 155681389) has the molecular formula C15F28 and a molecular weight of 712.11 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene |
|---|---|
| PubChem CID | 155681389 |
| Molecular Formula | C15F28 |
| Molecular Weight | 712.11 g/mol |
| Exact Mass | 711.96 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C1=C(C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C15F28/c16-3(12(32,33)34,7(22,23)10(28,29)14(38,39)40)1-2(6(20,21)9(26,27)5(1,18)19)4(17,13(35,36)37)8(24,25)11(30,31)15(41,42)43 |
| InChIKey | AXVMMVLIUJDTBD-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.11 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|