C13F24 — CID 155681393
3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene (PubChem CID 155681393) has the molecular formula C13F24 and a molecular weight of 612.09 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene |
|---|---|
| PubChem CID | 155681393 |
| Molecular Formula | C13F24 |
| Molecular Weight | 612.09 g/mol |
| Exact Mass | 611.96 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene |
| SMILES | FC(F)(F)C(C1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13F24/c14-5(15)1(3(8(20,21)22,9(23,24)25)10(26,27)28)2(6(16,17)7(5,18)19)4(11(29,30)31,12(32,33)34)13(35,36)37 |
| InChIKey | BOQALOAZSJWGOT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.09 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|