C10F18 — CID 155681396
1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexene (PubChem CID 155681396) has the molecular formula C10F18 and a molecular weight of 462.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 155681396 |
| Molecular Formula | C10F18 |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclohexene |
| SMILES | FC1=C(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F18/c11-2-1(3(12,9(23,24)25)6(17,18)10(26,27)28)4(13,14)7(19,20)8(21,22)5(2,15)16 |
| InChIKey | AMFDZAFRZZZAEY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|