C13F24 — CID 155681401
1,3,3,4,4,5,5,6,6-nonafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclohexene (PubChem CID 155681401) has the molecular formula C13F24 and a molecular weight of 612.09 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclohexene |
|---|---|
| PubChem CID | 155681401 |
| Molecular Formula | C13F24 |
| Molecular Weight | 612.09 g/mol |
| Exact Mass | 611.96 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclohexene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13F24/c14-2-1(4(15,16)8(22,23)9(24,25)5(2,17)18)3(10(26,27)28,11(29,30)31)7(20,21)6(19,12(32,33)34)13(35,36)37 |
| InChIKey | TUCBUKBRXSKBIW-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.09 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|