C11F20 — CID 155681407
1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene (PubChem CID 155681407) has the molecular formula C11F20 and a molecular weight of 512.08 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 155681407 |
| Molecular Formula | C11F20 |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclohexene |
| SMILES | FC1=C(C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F20/c12-2-1(4(14,15)7(20,21)8(22,23)5(2,16)17)3(13,10(26,27)28)6(18,19)9(24,25)11(29,30)31 |
| InChIKey | CSWFRNXHROGABF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|