C26H29NO10 — CID 155681563
methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate (PubChem CID 155681563) has the molecular formula C26H29NO10 and a molecular weight of 515.52 g/mol. Its IUPAC name is methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate.
| Compound Name | methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate |
|---|---|
| PubChem CID | 155681563 |
| Molecular Formula | C26H29NO10 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate |
| SMILES | C=CCOC(=O)NCCc1cc2c(c(OC)c1C1OC1c1ccc(OC)c(OC)c1C(=O)OC)OCO2 |
| InChI | InChI=1S/C26H29NO10/c1-6-11-34-26(29)27-10-9-14-12-17-22(36-13-35-17)23(32-4)18(14)24-20(37-24)15-7-8-16(30-2)21(31-3)19(15)25(28)33-5/h6-8,12,20,24H,1,9-11,13H2,2-5H3,(H,27,29) |
| InChIKey | UKSRCEYEBYNNIV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|