C35H36F5N5O2 — CID 155681796
2,5-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-(4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-7-yl)-4-(trifluoromethyl)aniline (PubChem CID 155681796) has the molecular formula C35H36F5N5O2 and a molecular weight of 653.70 g/mol. Its IUPAC name is 2,5-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-(4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-7-yl)-4-(trifluoromethyl)aniline.
| Compound Name | 2,5-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-(4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-7-yl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 155681796 |
| Molecular Formula | C35H36F5N5O2 |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 2,5-difluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-(4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-7-yl)-4-(trifluoromethyl)aniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(F)c(C(F)(F)F)c(C3CCc4c(ncnc4N4CCNCC4)C3)c2F)cc1 |
| InChI | InChI=1S/C35H36F5N5O2/c1-46-25-8-3-22(4-9-25)19-45(20-23-5-10-26(47-2)11-6-23)30-18-28(36)32(35(38,39)40)31(33(30)37)24-7-12-27-29(17-24)42-21-43-34(27)44-15-13-41-14-16-44/h3-6,8-11,18,21,24,41H,7,12-17,19-20H2,1-2H3 |
| InChIKey | GHPXAXUSYRDGHN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |