C11H13F2NO4 — CID 155682555
2-[(1R,6R,7S)-3,3-difluoro-7-(nitromethyl)-7-tricyclo[4.2.0.02,4]octanyl]acetic acid (PubChem CID 155682555) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-[(1R,6R,7S)-3,3-difluoro-7-(nitromethyl)-7-tricyclo[4.2.0.02,4]octanyl]acetic acid.
| Compound Name | 2-[(1R,6R,7S)-3,3-difluoro-7-(nitromethyl)-7-tricyclo[4.2.0.02,4]octanyl]acetic acid |
|---|---|
| PubChem CID | 155682555 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-[(1R,6R,7S)-3,3-difluoro-7-(nitromethyl)-7-tricyclo[4.2.0.02,4]octanyl]acetic acid |
| SMILES | O=C(O)C[C@@]1(C[N+](=O)[O-])C[C@H]2C3C(C[C@H]21)C3(F)F |
| InChI | InChI=1S/C11H13F2NO4/c12-11(13)7-1-6-5(9(7)11)2-10(6,3-8(15)16)4-14(17)18/h5-7,9H,1-4H2,(H,15,16)/t5-,6-,7?,9?,10-/m1/s1 |
| InChIKey | GWGXHVVMFXGMIU-VEOVYFJESA-N |
| XLogP | 1.65 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|