C22H17N5O2 — CID 155682689
3-[[(4-but-2-ynoyl-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-10-yl)amino]methyl]benzonitrile (PubChem CID 155682689) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[[(4-but-2-ynoyl-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-10-yl)amino]methyl]benzonitrile.
| Compound Name | 3-[[(4-but-2-ynoyl-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-10-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 155682689 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[[(4-but-2-ynoyl-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-10-yl)amino]methyl]benzonitrile |
| SMILES | CC#CC(=O)N1CCOc2c1ccc1ncnc(NCc3cccc(C#N)c3)c21 |
| InChI | InChI=1S/C22H17N5O2/c1-2-4-19(28)27-9-10-29-21-18(27)8-7-17-20(21)22(26-14-25-17)24-13-16-6-3-5-15(11-16)12-23/h3,5-8,11,14H,9-10,13H2,1H3,(H,24,25,26) |
| InChIKey | VMEJOGKNNZGSLK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|