C19H23N3O2 — CID 155682956
4-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)-2,2-dimethylbutanamide (PubChem CID 155682956) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)-2,2-dimethylbutanamide.
| Compound Name | 4-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 155682956 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)-2,2-dimethylbutanamide |
| SMILES | COc1ccc2c3ccnc(C)c3n(CCC(C)(C)C(N)=O)c2c1 |
| InChI | InChI=1S/C19H23N3O2/c1-12-17-15(7-9-21-12)14-6-5-13(24-4)11-16(14)22(17)10-8-19(2,3)18(20)23/h5-7,9,11H,8,10H2,1-4H3,(H2,20,23) |
| InChIKey | XQEZWPHXBNMKQW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |