C16H12Cl4N8 — CID 155683259
3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine (PubChem CID 155683259) has the molecular formula C16H12Cl4N8 and a molecular weight of 458.14 g/mol. Its IUPAC name is 3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine.
| Compound Name | 3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine |
|---|---|
| PubChem CID | 155683259 |
| Molecular Formula | C16H12Cl4N8 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine |
| SMILES | Cn1nccc1-c1cc(Cl)nnc1Cl.Cn1nccc1-c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/2C8H6Cl2N4/c2*1-14-6(2-3-11-14)5-4-7(9)12-13-8(5)10/h2*2-4H,1H3 |
| InChIKey | ZMTXZIYZWYFHDA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |