C17H21N5O5 — CID 155683566
ethyl 5-amino-7-(2,4,6-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 155683566) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 5-amino-7-(2,4,6-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-amino-7-(2,4,6-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 155683566 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 5-amino-7-(2,4,6-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Nc2ncnn2C1c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C17H21N5O5/c1-5-27-16(23)13-14(22-17(19-8-20-22)21-15(13)18)12-10(25-3)6-9(24-2)7-11(12)26-4/h6-8,14H,5,18H2,1-4H3,(H,19,20,21) |
| InChIKey | MBOCGEGNRPTSCX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |