C27H32FN5O5 — CID 155685129
[2-[2-(6-amino-2-fluoropurin-9-yl)ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 155685129) has the molecular formula C27H32FN5O5 and a molecular weight of 525.58 g/mol. Its IUPAC name is [2-[2-(6-amino-2-fluoropurin-9-yl)ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [2-[2-(6-amino-2-fluoropurin-9-yl)ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 155685129 |
| Molecular Formula | C27H32FN5O5 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [2-[2-(6-amino-2-fluoropurin-9-yl)ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#CC(CCn1cnc2c(N)nc(F)nc21)(COC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(C)=O)OC |
| InChI | InChI=1S/C27H32FN5O5/c1-8-27(36-7,9-10-33-15-30-22-23(29)31-25(28)32-24(22)33)14-37-20(35)13-26(5,6)21-17(3)11-16(2)12-19(21)38-18(4)34/h1,11-12,15H,9-10,13-14H2,2-7H3,(H2,29,31,32) |
| InChIKey | KSGQDLZMNPGTTL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|