C30H36FN5O6 — CID 155685152
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoate (PubChem CID 155685152) has the molecular formula C30H36FN5O6 and a molecular weight of 581.65 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 155685152 |
| Molecular Formula | C30H36FN5O6 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoate |
| SMILES | C#C[C@]1(COC(=O)CC(C)(C)c2c(C)cc(C)cc2OC(=O)C(C)(C)C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C30H36FN5O6/c1-9-30(19(37)12-20(42-30)36-15-33-23-24(32)34-27(31)35-25(23)36)14-40-21(38)13-29(7,8)22-17(3)10-16(2)11-18(22)41-26(39)28(4,5)6/h1,10-11,15,19-20,37H,12-14H2,2-8H3,(H2,32,34,35)/t19-,20+,30+/m0/s1 |
| InChIKey | SOLJKACXYCXQJH-FHFCDEBKSA-N |
| XLogP | 3.68 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|