About [4-(methoxymethyl)phenoxy]methanone;rhenium
[4-(methoxymethyl)phenoxy]methanone;rhenium (PubChem CID 155685310) has the molecular formula C9H9O3Re-
and a molecular weight of 351.38 g/mol. Its IUPAC name is [4-(methoxymethyl)phenoxy]methanone;rhenium.
Molecular Properties
| Compound Name | [4-(methoxymethyl)phenoxy]methanone;rhenium |
| PubChem CID | 155685310 |
| Molecular Formula | C9H9O3Re- |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | [4-(methoxymethyl)phenoxy]methanone;rhenium |
| SMILES | COCc1ccc(O[C-]=O)cc1.[Re] |
| InChI | InChI=1S/C9H9O3.Re/c1-11-6-8-2-4-9(5-3-8)12-7-10;/h2-5H,6H2,1H3;/q-1; |
| InChIKey | CWHMMJUKVCWIOM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [4-(methoxymethyl)phenoxy]methanone;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxymethyl)phenoxy]methanone;rhenium?
The IUPAC name of [4-(methoxymethyl)phenoxy]methanone;rhenium (CID 155685310) is [4-(methoxymethyl)phenoxy]methanone;rhenium.
What is the SMILES notation for [4-(methoxymethyl)phenoxy]methanone;rhenium?
The canonical SMILES for [4-(methoxymethyl)phenoxy]methanone;rhenium is COCc1ccc(O[C-]=O)cc1.[Re].
What is the InChIKey of [4-(methoxymethyl)phenoxy]methanone;rhenium?
The InChIKey is CWHMMJUKVCWIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O3.Re/c1-11-6-8-2-4-9(5-3-8)12-7-10;/h2-5H,6H2,1H3;/q-1;.
What are the key properties of [4-(methoxymethyl)phenoxy]methanone;rhenium?
[4-(methoxymethyl)phenoxy]methanone;rhenium has a molecular weight of 351.38 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxymethyl)phenoxy]methanone;rhenium is sourced from PubChem (CID 155685310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).