About hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid
hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid (PubChem CID 155685335) has the molecular formula C20H33O6PS
and a molecular weight of 432.52 g/mol. Its IUPAC name is hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid.
Molecular Properties
| Compound Name | hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid |
| PubChem CID | 155685335 |
| Molecular Formula | C20H33O6PS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid |
| SMILES | CCCCCC=O.COc1ccc(CSP(=O)(O)OCC2CCC(C)O2)cc1 |
| InChI | InChI=1S/C14H21O5PS.C6H12O/c1-11-3-6-14(19-11)9-18-20(15,16)21-10-12-4-7-13(17-2)8-5-12;1-2-3-4-5-6-7/h4-5,7-8,11,14H,3,6,9-10H2,1-2H3,(H,15,16);6H,2-5H2,1H3 |
| InChIKey | ONFBHAJUCCYHTD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid?
The IUPAC name of hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid (CID 155685335) is hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid.
What is the SMILES notation for hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid?
The canonical SMILES for hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid is CCCCCC=O.COc1ccc(CSP(=O)(O)OCC2CCC(C)O2)cc1.
What is the InChIKey of hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid?
The InChIKey is ONFBHAJUCCYHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21O5PS.C6H12O/c1-11-3-6-14(19-11)9-18-20(15,16)21-10-12-4-7-13(17-2)8-5-12;1-2-3-4-5-6-7/h4-5,7-8,11,14H,3,6,9-10H2,1-2H3,(H,15,16);6H,2-5H2,1H3.
What are the key properties of hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid?
hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid has a molecular weight of 432.52 g/mol, XLogP of 5.38, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hexanal;(4-methoxyphenyl)methylsulfanyl-[(5-methyloxolan-2-yl)methoxy]phosphinic acid is sourced from PubChem (CID 155685335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).