C23H15F9N4O4S — CID 155685446
2-[3-ethylsulfonyl-5-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2-pyridinyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 155685446) has the molecular formula C23H15F9N4O4S and a molecular weight of 614.45 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-5-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2-pyridinyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[3-ethylsulfonyl-5-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2-pyridinyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 155685446 |
| Molecular Formula | C23H15F9N4O4S |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | 2-[3-ethylsulfonyl-5-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]-2-pyridinyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(OC(C(F)(F)F)C(F)(F)F)cc2)cnc1-n1nc2ccc(C(F)(F)F)cn2c1=O |
| InChI | InChI=1S/C23H15F9N4O4S/c1-2-41(38,39)16-9-13(12-3-6-15(7-4-12)40-19(22(27,28)29)23(30,31)32)10-33-18(16)36-20(37)35-11-14(21(24,25)26)5-8-17(35)34-36/h3-11,19H,2H2,1H3 |
| InChIKey | HCXMIDKTUHVTGO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |