About (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone
(5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone (PubChem CID 155686450) has the molecular formula C11H10Cl2N4O2
and a molecular weight of 301.13 g/mol. Its IUPAC name is (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone |
| PubChem CID | 155686450 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone |
| SMILES | O=C(c1cn2c(Cl)cc(Cl)nc2n1)N1CCOCC1 |
| InChI | InChI=1S/C11H10Cl2N4O2/c12-8-5-9(13)17-6-7(14-11(17)15-8)10(18)16-1-3-19-4-2-16/h5-6H,1-4H2 |
| InChIKey | DJELLLCTDRDOJW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone?
The IUPAC name of (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone (CID 155686450) is (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone is O=C(c1cn2c(Cl)cc(Cl)nc2n1)N1CCOCC1.
What is the InChIKey of (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone?
The InChIKey is DJELLLCTDRDOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N4O2/c12-8-5-9(13)17-6-7(14-11(17)15-8)10(18)16-1-3-19-4-2-16/h5-6H,1-4H2.
What are the key properties of (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone?
(5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone has a molecular weight of 301.13 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dichloroimidazo[1,2-a]pyrimidin-2-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 155686450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).