C28H40ClF6N5O — CID 155686679
2-chloro-4-[[3-(difluoromethyl)-2-fluorophenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbaldehyde;N,3-dimethyl-N-(3,3,3-trifluoro-2-methylpropyl)pentan-1-amine;ethane (PubChem CID 155686679) has the molecular formula C28H40ClF6N5O and a molecular weight of 612.10 g/mol. Its IUPAC name is 2-chloro-4-[[3-(difluoromethyl)-2-fluorophenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbaldehyde;N,3-dimethyl-N-(3,3,3-trifluoro-2-methylpropyl)pentan-1-amine;ethane.
| Compound Name | 2-chloro-4-[[3-(difluoromethyl)-2-fluorophenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbaldehyde;N,3-dimethyl-N-(3,3,3-trifluoro-2-methylpropyl)pentan-1-amine;ethane |
|---|---|
| PubChem CID | 155686679 |
| Molecular Formula | C28H40ClF6N5O |
| Molecular Weight | 612.10 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 2-chloro-4-[[3-(difluoromethyl)-2-fluorophenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbaldehyde;N,3-dimethyl-N-(3,3,3-trifluoro-2-methylpropyl)pentan-1-amine;ethane |
| SMILES | CC.CCC(C)CCN(C)CC(C)C(F)(F)F.O=CN1Cc2nc(Cl)nc(NCc3cccc(C(F)F)c3F)c2C1 |
| InChI | InChI=1S/C15H12ClF3N4O.C11H22F3N.C2H6/c16-15-21-11-6-23(7-24)5-10(11)14(22-15)20-4-8-2-1-3-9(12(8)17)13(18)19;1-5-9(2)6-7-15(4)8-10(3)11(12,13)14;1-2/h1-3,7,13H,4-6H2,(H,20,21,22);9-10H,5-8H2,1-4H3;1-2H3 |
| InChIKey | AHIRNGCLPPTHHR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.10 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|