C22H24ClF3N6O2 — CID 155686915
[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-chloro-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone (PubChem CID 155686915) has the molecular formula C22H24ClF3N6O2 and a molecular weight of 496.92 g/mol. Its IUPAC name is [(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-chloro-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone.
| Compound Name | [(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-chloro-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone |
|---|---|
| PubChem CID | 155686915 |
| Molecular Formula | C22H24ClF3N6O2 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-chloro-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]methanone |
| SMILES | C[C@@H](Nc1nc(Cl)nc2c1CN(C(=O)N1C[C@H]3COC[C@H]3C1)C2)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24ClF3N6O2/c1-11(12-2-15(22(24,25)26)4-16(27)3-12)28-19-17-7-32(8-18(17)29-20(23)30-19)21(33)31-5-13-9-34-10-14(13)6-31/h2-4,11,13-14H,5-10,27H2,1H3,(H,28,29,30)/t11-,13-,14+/m1/s1 |
| InChIKey | KARFTSIUNSXJOP-BNOWGMLFSA-N |
| XLogP | 3.92 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|