About 1-bromotricyclo[3.1.0.02,6]hex-3-ene
1-bromotricyclo[3.1.0.02,6]hex-3-ene (PubChem CID 15568692) has the molecular formula C6H5Br
and a molecular weight of 157.01 g/mol. Its IUPAC name is 1-bromotricyclo[3.1.0.02,6]hex-3-ene.
Molecular Properties
| Compound Name | 1-bromotricyclo[3.1.0.02,6]hex-3-ene |
| PubChem CID | 15568692 |
| Molecular Formula | C6H5Br |
| Molecular Weight | 157.01 g/mol |
| Exact Mass | 155.96 |
| IUPAC Name | 1-bromotricyclo[3.1.0.02,6]hex-3-ene |
| SMILES | BrC12C3C=CC1C32 |
| InChI | InChI=1S/C6H5Br/c7-6-3-1-2-4(6)5(3)6/h1-5H |
| InChIKey | QPSSDOYJBVWROU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.01 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromotricyclo[3.1.0.02,6]hex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromotricyclo[3.1.0.02,6]hex-3-ene?
The IUPAC name of 1-bromotricyclo[3.1.0.02,6]hex-3-ene (CID 15568692) is 1-bromotricyclo[3.1.0.02,6]hex-3-ene.
What is the SMILES notation for 1-bromotricyclo[3.1.0.02,6]hex-3-ene?
The canonical SMILES for 1-bromotricyclo[3.1.0.02,6]hex-3-ene is BrC12C3C=CC1C32.
What is the InChIKey of 1-bromotricyclo[3.1.0.02,6]hex-3-ene?
The InChIKey is QPSSDOYJBVWROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br/c7-6-3-1-2-4(6)5(3)6/h1-5H.
What are the key properties of 1-bromotricyclo[3.1.0.02,6]hex-3-ene?
1-bromotricyclo[3.1.0.02,6]hex-3-ene has a molecular weight of 157.01 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromotricyclo[3.1.0.02,6]hex-3-ene is sourced from PubChem (CID 15568692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).