C24H29ClF3N5O — CID 155687020
7-[(3aR)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 155687020) has the molecular formula C24H29ClF3N5O and a molecular weight of 495.98 g/mol. Its IUPAC name is 7-[(3aR)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aR)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155687020 |
| Molecular Formula | C24H29ClF3N5O |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 7-[(3aR)-3a-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H](Nc1nc(Cl)nc2c1CNC(C1CCC3OCC[C@@]31C)C2)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H29ClF3N5O/c1-12(13-7-14(24(26,27)28)9-15(29)8-13)31-21-16-11-30-19(10-18(16)32-22(25)33-21)17-3-4-20-23(17,2)5-6-34-20/h7-9,12,17,19-20,30H,3-6,10-11,29H2,1-2H3,(H,31,32,33)/t12-,17?,19?,20?,23-/m1/s1 |
| InChIKey | KDDMJYDWNJPMID-UKIKZKEVSA-N |
| XLogP | 5.12 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|