C11H16N2O — CID 155687266
1-[3-[(1R)-1-aminoethyl]phenyl]azetidin-3-ol (PubChem CID 155687266) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-[3-[(1R)-1-aminoethyl]phenyl]azetidin-3-ol.
| Compound Name | 1-[3-[(1R)-1-aminoethyl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 155687266 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-[3-[(1R)-1-aminoethyl]phenyl]azetidin-3-ol |
| SMILES | C[C@@H](N)c1cccc(N2CC(O)C2)c1 |
| InChI | InChI=1S/C11H16N2O/c1-8(12)9-3-2-4-10(5-9)13-6-11(14)7-13/h2-5,8,11,14H,6-7,12H2,1H3/t8-/m1/s1 |
| InChIKey | UUKAPAYASUDDEI-MRVPVSSYSA-N |
| XLogP | 0.89 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |