C22H30ClF2N3 — CID 155687725
2-chloro-N-[[3-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-6-(5-methylhexyl)pyrimidin-4-amine (PubChem CID 155687725) has the molecular formula C22H30ClF2N3 and a molecular weight of 409.95 g/mol. Its IUPAC name is 2-chloro-N-[[3-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-6-(5-methylhexyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[[3-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-6-(5-methylhexyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 155687725 |
| Molecular Formula | C22H30ClF2N3 |
| Molecular Weight | 409.95 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-chloro-N-[[3-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-6-(5-methylhexyl)pyrimidin-4-amine |
| SMILES | CCc1c(CCCCC(C)C)nc(Cl)nc1NCc1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C22H30ClF2N3/c1-5-18-19(12-7-6-9-15(2)3)27-21(23)28-20(18)26-14-16-10-8-11-17(13-16)22(4,24)25/h8,10-11,13,15H,5-7,9,12,14H2,1-4H3,(H,26,27,28) |
| InChIKey | SCDXTGPYNZYYJI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.95 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|