About 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane
4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane (PubChem CID 155687907) has the molecular formula C8H12ClN3
and a molecular weight of 185.66 g/mol. Its IUPAC name is 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane |
| PubChem CID | 155687907 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane |
| SMILES | C.Cc1nc(Cl)c2c(n1)CNC2 |
| InChI | InChI=1S/C7H8ClN3.CH4/c1-4-10-6-3-9-2-5(6)7(8)11-4;/h9H,2-3H2,1H3;1H4 |
| InChIKey | TZUXNPJFWPJXLC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane?
The IUPAC name of 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane (CID 155687907) is 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane.
What is the SMILES notation for 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane?
The canonical SMILES for 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane is C.Cc1nc(Cl)c2c(n1)CNC2.
What is the InChIKey of 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane?
The InChIKey is TZUXNPJFWPJXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3.CH4/c1-4-10-6-3-9-2-5(6)7(8)11-4;/h9H,2-3H2,1H3;1H4.
What are the key properties of 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane?
4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane has a molecular weight of 185.66 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;methane is sourced from PubChem (CID 155687907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).