About 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde
4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde (PubChem CID 15568808) has the molecular formula C14H10O6
and a molecular weight of 274.23 g/mol. Its IUPAC name is 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde.
Molecular Properties
| Compound Name | 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde |
| PubChem CID | 15568808 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde |
| SMILES | COc1c2occc2c(OC)c2c(=O)c(C=O)coc12 |
| InChI | InChI=1S/C14H10O6/c1-17-11-8-3-4-19-12(8)14(18-2)13-9(11)10(16)7(5-15)6-20-13/h3-6H,1-2H3 |
| InChIKey | UELAHFBJLGTYAF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde?
The IUPAC name of 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde (CID 15568808) is 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde.
What is the SMILES notation for 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde?
The canonical SMILES for 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde is COc1c2occc2c(OC)c2c(=O)c(C=O)coc12.
What is the InChIKey of 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde?
The InChIKey is UELAHFBJLGTYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O6/c1-17-11-8-3-4-19-12(8)14(18-2)13-9(11)10(16)7(5-15)6-20-13/h3-6H,1-2H3.
What are the key properties of 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde?
4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde has a molecular weight of 274.23 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethoxy-5-oxofuro[3,2-g]chromene-6-carbaldehyde is sourced from PubChem (CID 15568808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).