C26H31ClF3IN4O — CID 155688156
3-[2-chloro-4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-6-yl]-1-[(8S)-8-iodoazocan-4-yl]propan-1-one (PubChem CID 155688156) has the molecular formula C26H31ClF3IN4O and a molecular weight of 634.91 g/mol. Its IUPAC name is 3-[2-chloro-4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-6-yl]-1-[(8S)-8-iodoazocan-4-yl]propan-1-one.
| Compound Name | 3-[2-chloro-4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-6-yl]-1-[(8S)-8-iodoazocan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 155688156 |
| Molecular Formula | C26H31ClF3IN4O |
| Molecular Weight | 634.91 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | 3-[2-chloro-4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-6-yl]-1-[(8S)-8-iodoazocan-4-yl]propan-1-one |
| SMILES | C[C@@H](Nc1nc(Cl)nc2c1CC(CCC(=O)C1CCC[C@H](I)NCC1)C2)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C26H31ClF3IN4O/c1-14(17-5-3-6-18(23(17)28)24(29)30)33-25-19-12-15(13-20(19)34-26(27)35-25)8-9-21(36)16-4-2-7-22(31)32-11-10-16/h3,5-6,14-16,22,24,32H,2,4,7-13H2,1H3,(H,33,34,35)/t14-,15?,16?,22-/m1/s1 |
| InChIKey | NRXHLSHFSZMOHQ-VBCZASBNSA-N |
| XLogP | 6.98 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.91 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|