C28H37N5O — CID 155689241
N-[4-[2-(dipropylamino)ethyl]phenyl]-3-[(4-ethylpyrimidin-2-yl)amino]-4-methylbenzamide (PubChem CID 155689241) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is N-[4-[2-(dipropylamino)ethyl]phenyl]-3-[(4-ethylpyrimidin-2-yl)amino]-4-methylbenzamide.
| Compound Name | N-[4-[2-(dipropylamino)ethyl]phenyl]-3-[(4-ethylpyrimidin-2-yl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 155689241 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | N-[4-[2-(dipropylamino)ethyl]phenyl]-3-[(4-ethylpyrimidin-2-yl)amino]-4-methylbenzamide |
| SMILES | CCCN(CCC)CCc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(CC)n3)c2)cc1 |
| InChI | InChI=1S/C28H37N5O/c1-5-17-33(18-6-2)19-15-22-9-12-25(13-10-22)30-27(34)23-11-8-21(4)26(20-23)32-28-29-16-14-24(7-3)31-28/h8-14,16,20H,5-7,15,17-19H2,1-4H3,(H,30,34)(H,29,31,32) |
| InChIKey | NGDJKDMMXVAFFP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |