C21H20N6O2 — CID 155689339
11-amino-20-oxa-1,5,8,12,27-pentazapentacyclo[19.2.2.110,14.115,19.02,7]heptacosa-2(7),3,5,10(27),11,13,15(26),16,18-nonaen-9-one (PubChem CID 155689339) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 11-amino-20-oxa-1,5,8,12,27-pentazapentacyclo[19.2.2.110,14.115,19.02,7]heptacosa-2(7),3,5,10(27),11,13,15(26),16,18-nonaen-9-one.
| Compound Name | 11-amino-20-oxa-1,5,8,12,27-pentazapentacyclo[19.2.2.110,14.115,19.02,7]heptacosa-2(7),3,5,10(27),11,13,15(26),16,18-nonaen-9-one |
|---|---|
| PubChem CID | 155689339 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 11-amino-20-oxa-1,5,8,12,27-pentazapentacyclo[19.2.2.110,14.115,19.02,7]heptacosa-2(7),3,5,10(27),11,13,15(26),16,18-nonaen-9-one |
| SMILES | Nc1ncc2nc1C(=O)Nc1cnccc1N1CCC(CC1)Oc1cccc-2c1 |
| InChI | InChI=1S/C21H20N6O2/c22-20-19-21(28)26-17-11-23-7-4-18(17)27-8-5-14(6-9-27)29-15-3-1-2-13(10-15)16(25-19)12-24-20/h1-4,7,10-12,14H,5-6,8-9H2,(H2,22,24)(H,26,28) |
| InChIKey | BBMBXQRDLKQANC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |