About 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol
2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 155689585) has the molecular formula C13H18Cl2N4O4
and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol |
| PubChem CID | 155689585 |
| Molecular Formula | C13H18Cl2N4O4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCn1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C13H18Cl2N4O4/c14-11-10-12(18-13(15)17-11)19(9-16-10)1-3-21-5-7-23-8-6-22-4-2-20/h9,20H,1-8H2 |
| InChIKey | YZEMZXINZOBCJC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol?
The IUPAC name of 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol (CID 155689585) is 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol?
The canonical SMILES for 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol is OCCOCCOCCOCCn1cnc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol?
The InChIKey is YZEMZXINZOBCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N4O4/c14-11-10-12(18-13(15)17-11)19(9-16-10)1-3-21-5-7-23-8-6-22-4-2-20/h9,20H,1-8H2.
What are the key properties of 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol?
2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol has a molecular weight of 365.22 g/mol, XLogP of 1.18, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(2,6-dichloropurin-9-yl)ethoxy]ethoxy]ethoxy]ethanol is sourced from PubChem (CID 155689585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).