C23H27N3O5S — CID 155690163
N-(2-aminooxyethyl)-N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-2-(3-methylsulfonylphenyl)acetamide (PubChem CID 155690163) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-(2-aminooxyethyl)-N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-2-(3-methylsulfonylphenyl)acetamide.
| Compound Name | N-(2-aminooxyethyl)-N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-2-(3-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 155690163 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-(2-aminooxyethyl)-N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-2-(3-methylsulfonylphenyl)acetamide |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(CCON)C(=O)Cc3cccc(S(C)(=O)=O)c3)cc2c1 |
| InChI | InChI=1S/C23H27N3O5S/c1-15-9-16(2)22-18(10-15)13-19(23(28)25-22)14-26(7-8-31-24)21(27)12-17-5-4-6-20(11-17)32(3,29)30/h4-6,9-11,13H,7-8,12,14,24H2,1-3H3,(H,25,28) |
| InChIKey | QZNXYDHVSIINRJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|