About 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone
1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone (PubChem CID 155690571) has the molecular formula C12H14F3N3O
and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone |
| PubChem CID | 155690571 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone |
| SMILES | C/C=C(C(=N\C)\C(F)(F)F)/c1cnc(C(C)=O)n1C |
| InChI | InChI=1S/C12H14F3N3O/c1-5-8(10(16-3)12(13,14)15)9-6-17-11(7(2)19)18(9)4/h5-6H,1-4H3/b8-5-,16-10- |
| InChIKey | SJMODUZTKQGOHB-MUOKUHRESA-N |
| XLogP | 2.66 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone?
The IUPAC name of 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone (CID 155690571) is 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone.
What is the SMILES notation for 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone?
The canonical SMILES for 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone is C/C=C(C(=N\C)\C(F)(F)F)/c1cnc(C(C)=O)n1C.
What is the InChIKey of 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone?
The InChIKey is SJMODUZTKQGOHB-MUOKUHRESA-N. The full InChI is InChI=1S/C12H14F3N3O/c1-5-8(10(16-3)12(13,14)15)9-6-17-11(7(2)19)18(9)4/h5-6H,1-4H3/b8-5-,16-10-.
What are the key properties of 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone?
1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone has a molecular weight of 273.26 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-methyl-5-[(Z)-5,5,5-trifluoro-4-methyliminopent-2-en-3-yl]imidazol-2-yl]ethanone is sourced from PubChem (CID 155690571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).