C7H5ClN2O2 — CID 155691308
6-chloro-1,4-dihydropyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 155691308) has the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. Its IUPAC name is 6-chloro-1,4-dihydropyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-chloro-1,4-dihydropyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 155691308 |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 6-chloro-1,4-dihydropyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | O=C1Nc2cnc(Cl)cc2CO1 |
| InChI | InChI=1S/C7H5ClN2O2/c8-6-1-4-3-12-7(11)10-5(4)2-9-6/h1-2H,3H2,(H,10,11) |
| InChIKey | AVTXAHSAYWKETQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|