About 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane
2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane (PubChem CID 155691970) has the molecular formula C10H13F2NO2
and a molecular weight of 217.22 g/mol. Its IUPAC name is 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane.
Molecular Properties
| Compound Name | 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane |
| PubChem CID | 155691970 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane |
| SMILES | CC.Cc1ccc2c(c1N)OC(F)(F)O2 |
| InChI | InChI=1S/C8H7F2NO2.C2H6/c1-4-2-3-5-7(6(4)11)13-8(9,10)12-5;1-2/h2-3H,11H2,1H3;1-2H3 |
| InChIKey | WQHFVXATSZSXEZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane?
The IUPAC name of 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane (CID 155691970) is 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane.
What is the SMILES notation for 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane?
The canonical SMILES for 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane is CC.Cc1ccc2c(c1N)OC(F)(F)O2.
What is the InChIKey of 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane?
The InChIKey is WQHFVXATSZSXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO2.C2H6/c1-4-2-3-5-7(6(4)11)13-8(9,10)12-5;1-2/h2-3H,11H2,1H3;1-2H3.
What are the key properties of 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane?
2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane has a molecular weight of 217.22 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-methyl-1,3-benzodioxol-4-amine;ethane is sourced from PubChem (CID 155691970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).