C24H28ClFN6O7 — CID 155692095
tert-butyl N-[6-chloro-3-[[(2R)-1-[(2-fluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-N-methylcarbamate (PubChem CID 155692095) has the molecular formula C24H28ClFN6O7 and a molecular weight of 566.97 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-3-[[(2R)-1-[(2-fluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[6-chloro-3-[[(2R)-1-[(2-fluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155692095 |
| Molecular Formula | C24H28ClFN6O7 |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | tert-butyl N-[6-chloro-3-[[(2R)-1-[(2-fluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-N-methylcarbamate |
| SMILES | COc1cc(F)c(COC[C@@H](C)NC(=O)c2cnc3c(N(C)C(=O)OC(C)(C)C)cc(Cl)nn23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28ClFN6O7/c1-13(11-38-12-14-7-16(32(35)36)19(37-6)8-15(14)26)28-22(33)18-10-27-21-17(9-20(25)29-31(18)21)30(5)23(34)39-24(2,3)4/h7-10,13H,11-12H2,1-6H3,(H,28,33)/t13-/m1/s1 |
| InChIKey | PRQHMKNAWGQZFO-CYBMUJFWSA-N |
| XLogP | 4.14 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|