About [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate
[(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate (PubChem CID 155693408) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate.
Molecular Properties
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate |
| PubChem CID | 155693408 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate |
| SMILES | C=C/C=C(\C=C)COC(=O)C(C=C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO4/c1-7-10-12(8-2)11-20-14(18)13(9-3)17-15(19)21-16(4,5)6/h7-10,13H,1-3,11H2,4-6H3,(H,17,19)/b12-10+ |
| InChIKey | COEBKJQNHOPGKK-ZRDIBKRKSA-N |
| XLogP | 2.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate?
The IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate (CID 155693408) is [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate.
What is the SMILES notation for [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate?
The canonical SMILES for [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate is C=C/C=C(\C=C)COC(=O)C(C=C)NC(=O)OC(C)(C)C.
What is the InChIKey of [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate?
The InChIKey is COEBKJQNHOPGKK-ZRDIBKRKSA-N. The full InChI is InChI=1S/C16H23NO4/c1-7-10-12(8-2)11-20-14(18)13(9-3)17-15(19)21-16(4,5)6/h7-10,13H,1-3,11H2,4-6H3,(H,17,19)/b12-10+.
What are the key properties of [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate?
[(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate has a molecular weight of 293.36 g/mol, XLogP of 2.91, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-ethenylpenta-2,4-dienyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoate is sourced from PubChem (CID 155693408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).