About acetaldehyde;bicyclo[3.2.1]octane
acetaldehyde;bicyclo[3.2.1]octane (PubChem CID 155693421) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is acetaldehyde;bicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | acetaldehyde;bicyclo[3.2.1]octane |
| PubChem CID | 155693421 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | acetaldehyde;bicyclo[3.2.1]octane |
| SMILES | C1CC2CCC(C1)C2.CC=O |
| InChI | InChI=1S/C8H14.C2H4O/c1-2-7-4-5-8(3-1)6-7;1-2-3/h7-8H,1-6H2;2H,1H3 |
| InChIKey | MTYFZSIEFCNNGY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;bicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;bicyclo[3.2.1]octane?
The IUPAC name of acetaldehyde;bicyclo[3.2.1]octane (CID 155693421) is acetaldehyde;bicyclo[3.2.1]octane.
What is the SMILES notation for acetaldehyde;bicyclo[3.2.1]octane?
The canonical SMILES for acetaldehyde;bicyclo[3.2.1]octane is C1CC2CCC(C1)C2.CC=O.
What is the InChIKey of acetaldehyde;bicyclo[3.2.1]octane?
The InChIKey is MTYFZSIEFCNNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C2H4O/c1-2-7-4-5-8(3-1)6-7;1-2-3/h7-8H,1-6H2;2H,1H3.
What are the key properties of acetaldehyde;bicyclo[3.2.1]octane?
acetaldehyde;bicyclo[3.2.1]octane has a molecular weight of 154.25 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;bicyclo[3.2.1]octane is sourced from PubChem (CID 155693421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).