C7H13ClN2 — CID 155693636
(1E,3Z)-1-chloro-2-ethylpenta-1,3-diene-1,4-diamine (PubChem CID 155693636) has the molecular formula C7H13ClN2 and a molecular weight of 160.65 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-2-ethylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-chloro-2-ethylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 155693636 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | (1E,3Z)-1-chloro-2-ethylpenta-1,3-diene-1,4-diamine |
| SMILES | CCC(/C=C(/C)N)=C(/N)Cl |
| InChI | InChI=1S/C7H13ClN2/c1-3-6(7(8)10)4-5(2)9/h4H,3,9-10H2,1-2H3/b5-4-,7-6- |
| InChIKey | AOWJDGQICDKJLI-RZSVFLSASA-N |
| XLogP | 1.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|