C8H15N3O — CID 155693973
1-[(1,5-dimethylpyrazol-4-yl)methylamino]ethanol (PubChem CID 155693973) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methylamino]ethanol.
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 155693973 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methylamino]ethanol |
| SMILES | Cc1c(CNC(C)O)cnn1C |
| InChI | InChI=1S/C8H15N3O/c1-6-8(4-9-7(2)12)5-10-11(6)3/h5,7,9,12H,4H2,1-3H3 |
| InChIKey | WDEVXIUIBPHGJZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|