About N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen
N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen (PubChem CID 155693996) has the molecular formula C7H13F2NO
and a molecular weight of 165.18 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen |
| PubChem CID | 155693996 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen |
| SMILES | CC(=O)NCC1CC(F)(F)C1.[H][H] |
| InChI | InChI=1S/C7H11F2NO.H2/c1-5(11)10-4-6-2-7(8,9)3-6;/h6H,2-4H2,1H3,(H,10,11);1H |
| InChIKey | STWCFGQYRSQPNJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen?
The IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen (CID 155693996) is N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen.
What is the SMILES notation for N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen?
The canonical SMILES for N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen is CC(=O)NCC1CC(F)(F)C1.[H][H].
What is the InChIKey of N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen?
The InChIKey is STWCFGQYRSQPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO.H2/c1-5(11)10-4-6-2-7(8,9)3-6;/h6H,2-4H2,1H3,(H,10,11);1H.
What are the key properties of N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen?
N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen has a molecular weight of 165.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclobutyl)methyl]acetamide;molecular hydrogen is sourced from PubChem (CID 155693996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).