C24H22FN2OS — CID 155694070
CID 155694070 (PubChem CID 155694070) has the molecular formula C24H22FN2OS and a molecular weight of 405.52 g/mol.
| Compound Name | CID 155694070 |
|---|---|
| PubChem CID | 155694070 |
| Molecular Formula | C24H22FN2OS |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccccc1CCC(=S)Nc1cc(C(=O)Nc2cccc(F)c2)ccc1C |
| InChI | InChI=1S/C24H22FN2OS/c1-16-6-3-4-7-18(16)12-13-23(29)27-22-14-19(11-10-17(22)2)24(28)26-21-9-5-8-20(25)15-21/h3-11,14-15H,1,12-13H2,2H3,(H,26,28)(H,27,29) |
| InChIKey | UJRUYXYSDUJNQX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|