C24H23Cl2FN2O4 — CID 155694759
2-[4-(2,6-dichloro-4-fluorophenyl)quinolin-7-yl]oxy-1-piperidin-1-ylpropan-1-one;formic acid (PubChem CID 155694759) has the molecular formula C24H23Cl2FN2O4 and a molecular weight of 493.36 g/mol. Its IUPAC name is 2-[4-(2,6-dichloro-4-fluorophenyl)quinolin-7-yl]oxy-1-piperidin-1-ylpropan-1-one;formic acid.
| Compound Name | 2-[4-(2,6-dichloro-4-fluorophenyl)quinolin-7-yl]oxy-1-piperidin-1-ylpropan-1-one;formic acid |
|---|---|
| PubChem CID | 155694759 |
| Molecular Formula | C24H23Cl2FN2O4 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-[4-(2,6-dichloro-4-fluorophenyl)quinolin-7-yl]oxy-1-piperidin-1-ylpropan-1-one;formic acid |
| SMILES | CC(Oc1ccc2c(-c3c(Cl)cc(F)cc3Cl)ccnc2c1)C(=O)N1CCCCC1.O=CO |
| InChI | InChI=1S/C23H21Cl2FN2O2.CH2O2/c1-14(23(29)28-9-3-2-4-10-28)30-16-5-6-17-18(7-8-27-21(17)13-16)22-19(24)11-15(26)12-20(22)25;2-1-3/h5-8,11-14H,2-4,9-10H2,1H3;1H,(H,2,3) |
| InChIKey | FONBOHREHDSPSK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|