About 4-butan-2-yl-2,3-bis(ethenyl)thiophene
4-butan-2-yl-2,3-bis(ethenyl)thiophene (PubChem CID 155694915) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is 4-butan-2-yl-2,3-bis(ethenyl)thiophene.
Molecular Properties
| Compound Name | 4-butan-2-yl-2,3-bis(ethenyl)thiophene |
| PubChem CID | 155694915 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-butan-2-yl-2,3-bis(ethenyl)thiophene |
| SMILES | C=Cc1scc(C(C)CC)c1C=C |
| InChI | InChI=1S/C12H16S/c1-5-9(4)11-8-13-12(7-3)10(11)6-2/h6-9H,2-3,5H2,1,4H3 |
| InChIKey | MYXQJQVKVCDELR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butan-2-yl-2,3-bis(ethenyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2,3-bis(ethenyl)thiophene?
The IUPAC name of 4-butan-2-yl-2,3-bis(ethenyl)thiophene (CID 155694915) is 4-butan-2-yl-2,3-bis(ethenyl)thiophene.
What is the SMILES notation for 4-butan-2-yl-2,3-bis(ethenyl)thiophene?
The canonical SMILES for 4-butan-2-yl-2,3-bis(ethenyl)thiophene is C=Cc1scc(C(C)CC)c1C=C.
What is the InChIKey of 4-butan-2-yl-2,3-bis(ethenyl)thiophene?
The InChIKey is MYXQJQVKVCDELR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S/c1-5-9(4)11-8-13-12(7-3)10(11)6-2/h6-9H,2-3,5H2,1,4H3.
What are the key properties of 4-butan-2-yl-2,3-bis(ethenyl)thiophene?
4-butan-2-yl-2,3-bis(ethenyl)thiophene has a molecular weight of 192.33 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2,3-bis(ethenyl)thiophene is sourced from PubChem (CID 155694915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).